C23H20N2O5S2 — CID 38959218
[4-(thiophene-2-carbonylamino)phenyl] (E)-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enoate (PubChem CID 38959218) has the molecular formula C23H20N2O5S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] (E)-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enoate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] (E)-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 38959218 |
| Molecular Formula | C23H20N2O5S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] (E)-3-[4-(cyclopropylsulfamoyl)phenyl]prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(S(=O)(=O)NC2CC2)cc1)Oc1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C23H20N2O5S2/c26-22(14-5-16-3-12-20(13-4-16)32(28,29)25-18-6-7-18)30-19-10-8-17(9-11-19)24-23(27)21-2-1-15-31-21/h1-5,8-15,18,25H,6-7H2,(H,24,27)/b14-5+ |
| InChIKey | BVKGXAQEKXLGEZ-LHHJGKSTSA-N |
| XLogP | 4.06 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|