C17H13ClN2O3S2 — CID 94151005
N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 94151005) has the molecular formula C17H13ClN2O3S2 and a molecular weight of 392.89 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 94151005 |
| Molecular Formula | C17H13ClN2O3S2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1)c1cccs1 |
| InChI | InChI=1S/C17H13ClN2O3S2/c18-12-3-5-14(6-4-12)20-25(22,23)15-9-7-13(8-10-15)19-17(21)16-2-1-11-24-16/h1-11,20H,(H,19,21) |
| InChIKey | RRODVNFKGJZCKD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |