C23H20ClNO5S2 — CID 39675902
[4-(thiophene-2-carbonylamino)phenyl] 1-(4-chlorophenyl)sulfonylcyclopentane-1-carboxylate (PubChem CID 39675902) has the molecular formula C23H20ClNO5S2 and a molecular weight of 490.00 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] 1-(4-chlorophenyl)sulfonylcyclopentane-1-carboxylate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] 1-(4-chlorophenyl)sulfonylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 39675902 |
| Molecular Formula | C23H20ClNO5S2 |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] 1-(4-chlorophenyl)sulfonylcyclopentane-1-carboxylate |
| SMILES | O=C(Nc1ccc(OC(=O)C2(S(=O)(=O)c3ccc(Cl)cc3)CCCC2)cc1)c1cccs1 |
| InChI | InChI=1S/C23H20ClNO5S2/c24-16-5-11-19(12-6-16)32(28,29)23(13-1-2-14-23)22(27)30-18-9-7-17(8-10-18)25-21(26)20-4-3-15-31-20/h3-12,15H,1-2,13-14H2,(H,25,26) |
| InChIKey | XFJXEVQDMHRQOS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|