C20H22ClNO5S2 — CID 55496237
1-(4-chlorophenyl)sulfonyl-N-(4-ethylsulfonylphenyl)cyclopentane-1-carboxamide (PubChem CID 55496237) has the molecular formula C20H22ClNO5S2 and a molecular weight of 455.99 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-(4-ethylsulfonylphenyl)cyclopentane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-(4-ethylsulfonylphenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 55496237 |
| Molecular Formula | C20H22ClNO5S2 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-(4-ethylsulfonylphenyl)cyclopentane-1-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)C2(S(=O)(=O)c3ccc(Cl)cc3)CCCC2)cc1 |
| InChI | InChI=1S/C20H22ClNO5S2/c1-2-28(24,25)17-11-7-16(8-12-17)22-19(23)20(13-3-4-14-20)29(26,27)18-9-5-15(21)6-10-18/h5-12H,2-4,13-14H2,1H3,(H,22,23) |
| InChIKey | PFJOBTFWNNRPOZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |