C20H20Cl2N2O4S — CID 55917246
N-(5-acetamido-2-chlorophenyl)-1-(4-chlorophenyl)sulfonylcyclopentane-1-carboxamide (PubChem CID 55917246) has the molecular formula C20H20Cl2N2O4S and a molecular weight of 455.36 g/mol. Its IUPAC name is N-(5-acetamido-2-chlorophenyl)-1-(4-chlorophenyl)sulfonylcyclopentane-1-carboxamide.
| Compound Name | N-(5-acetamido-2-chlorophenyl)-1-(4-chlorophenyl)sulfonylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 55917246 |
| Molecular Formula | C20H20Cl2N2O4S |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | N-(5-acetamido-2-chlorophenyl)-1-(4-chlorophenyl)sulfonylcyclopentane-1-carboxamide |
| SMILES | CC(=O)Nc1ccc(Cl)c(NC(=O)C2(S(=O)(=O)c3ccc(Cl)cc3)CCCC2)c1 |
| InChI | InChI=1S/C20H20Cl2N2O4S/c1-13(25)23-15-6-9-17(22)18(12-15)24-19(26)20(10-2-3-11-20)29(27,28)16-7-4-14(21)5-8-16/h4-9,12H,2-3,10-11H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | OWDMHLLANQMVKG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |