C16H13Cl2NO3S — CID 15999936
N-(2-chlorophenyl)-1-(4-chlorophenyl)sulfonylcyclopropane-1-carboxamide (PubChem CID 15999936) has the molecular formula C16H13Cl2NO3S and a molecular weight of 370.26 g/mol. Its IUPAC name is N-(2-chlorophenyl)-1-(4-chlorophenyl)sulfonylcyclopropane-1-carboxamide.
| Compound Name | N-(2-chlorophenyl)-1-(4-chlorophenyl)sulfonylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 15999936 |
| Molecular Formula | C16H13Cl2NO3S |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | N-(2-chlorophenyl)-1-(4-chlorophenyl)sulfonylcyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)C1(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H13Cl2NO3S/c17-11-5-7-12(8-6-11)23(21,22)16(9-10-16)15(20)19-14-4-2-1-3-13(14)18/h1-8H,9-10H2,(H,19,20) |
| InChIKey | GKYYELJJEIKTGN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |