C25H24ClN3O4S — CID 31825356
1-(4-chlorophenyl)sulfonyl-N-[4-(phenylcarbamoylamino)phenyl]cyclopentane-1-carboxamide (PubChem CID 31825356) has the molecular formula C25H24ClN3O4S and a molecular weight of 498.00 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-[4-(phenylcarbamoylamino)phenyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-[4-(phenylcarbamoylamino)phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 31825356 |
| Molecular Formula | C25H24ClN3O4S |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-[4-(phenylcarbamoylamino)phenyl]cyclopentane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(NC(=O)C2(S(=O)(=O)c3ccc(Cl)cc3)CCCC2)cc1 |
| InChI | InChI=1S/C25H24ClN3O4S/c26-18-8-14-22(15-9-18)34(32,33)25(16-4-5-17-25)23(30)27-20-10-12-21(13-11-20)29-24(31)28-19-6-2-1-3-7-19/h1-3,6-15H,4-5,16-17H2,(H,27,30)(H2,28,29,31) |
| InChIKey | KGDJKIJLFFHCIL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |