C20H23NO4S — CID 17390768
1-(benzenesulfonyl)-N-(4-ethoxyphenyl)cyclopentane-1-carboxamide (PubChem CID 17390768) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(4-ethoxyphenyl)cyclopentane-1-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(4-ethoxyphenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 17390768 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(4-ethoxyphenyl)cyclopentane-1-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2(S(=O)(=O)c3ccccc3)CCCC2)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-2-25-17-12-10-16(11-13-17)21-19(22)20(14-6-7-15-20)26(23,24)18-8-4-3-5-9-18/h3-5,8-13H,2,6-7,14-15H2,1H3,(H,21,22) |
| InChIKey | ZEBAMCCVKUWYQG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |