C23H30N2O2 — CID 95100675
(4S)-N-(4-ethoxyphenyl)-1-ethyl-4-phenylazepane-4-carboxamide (PubChem CID 95100675) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is (4S)-N-(4-ethoxyphenyl)-1-ethyl-4-phenylazepane-4-carboxamide.
| Compound Name | (4S)-N-(4-ethoxyphenyl)-1-ethyl-4-phenylazepane-4-carboxamide |
|---|---|
| PubChem CID | 95100675 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | (4S)-N-(4-ethoxyphenyl)-1-ethyl-4-phenylazepane-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@]2(c3ccccc3)CCCN(CC)CC2)cc1 |
| InChI | InChI=1S/C23H30N2O2/c1-3-25-17-8-15-23(16-18-25,19-9-6-5-7-10-19)22(26)24-20-11-13-21(14-12-20)27-4-2/h5-7,9-14H,3-4,8,15-18H2,1-2H3,(H,24,26)/t23-/m0/s1 |
| InChIKey | RZGKQCQEHNPBLN-QHCPKHFHSA-N |
| XLogP | 4.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |