C22H28N2OS — CID 53165493
1-ethyl-N-(4-methylsulfanylphenyl)-4-phenylazepane-4-carboxamide (PubChem CID 53165493) has the molecular formula C22H28N2OS and a molecular weight of 368.55 g/mol. Its IUPAC name is 1-ethyl-N-(4-methylsulfanylphenyl)-4-phenylazepane-4-carboxamide.
| Compound Name | 1-ethyl-N-(4-methylsulfanylphenyl)-4-phenylazepane-4-carboxamide |
|---|---|
| PubChem CID | 53165493 |
| Molecular Formula | C22H28N2OS |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 1-ethyl-N-(4-methylsulfanylphenyl)-4-phenylazepane-4-carboxamide |
| SMILES | CCN1CCCC(C(=O)Nc2ccc(SC)cc2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H28N2OS/c1-3-24-16-7-14-22(15-17-24,18-8-5-4-6-9-18)21(25)23-19-10-12-20(26-2)13-11-19/h4-6,8-13H,3,7,14-17H2,1-2H3,(H,23,25) |
| InChIKey | RZUAIYCCNXHRIQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |