C22H27N3O4 — CID 3053611
N-[(4-ethoxyphenyl)carbamoyl]-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetamide (PubChem CID 3053611) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)carbamoyl]-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetamide.
| Compound Name | N-[(4-ethoxyphenyl)carbamoyl]-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 3053611 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-[(4-ethoxyphenyl)carbamoyl]-2-(4-hydroxy-4-phenylpiperidin-1-yl)acetamide |
| SMILES | CCOc1ccc(NC(=O)NC(=O)CN2CCC(O)(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H27N3O4/c1-2-29-19-10-8-18(9-11-19)23-21(27)24-20(26)16-25-14-12-22(28,13-15-25)17-6-4-3-5-7-17/h3-11,28H,2,12-16H2,1H3,(H2,23,24,26,27) |
| InChIKey | WBMVMODRKQPEII-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |