C21H25N3O4 — CID 3053609
2-(4-hydroxy-4-phenylpiperidin-1-yl)-N-[(4-methoxyphenyl)carbamoyl]acetamide (PubChem CID 3053609) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-(4-hydroxy-4-phenylpiperidin-1-yl)-N-[(4-methoxyphenyl)carbamoyl]acetamide.
| Compound Name | 2-(4-hydroxy-4-phenylpiperidin-1-yl)-N-[(4-methoxyphenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 3053609 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-(4-hydroxy-4-phenylpiperidin-1-yl)-N-[(4-methoxyphenyl)carbamoyl]acetamide |
| SMILES | COc1ccc(NC(=O)NC(=O)CN2CCC(O)(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-28-18-9-7-17(8-10-18)22-20(26)23-19(25)15-24-13-11-21(27,12-14-24)16-5-3-2-4-6-16/h2-10,27H,11-15H2,1H3,(H2,22,23,25,26) |
| InChIKey | JAAFKMGLHLUEFY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |