C22H28N2O4 — CID 50980551
N-(2,4-dimethoxyphenyl)-3-(4-hydroxy-4-phenylpiperidin-1-yl)propanamide (PubChem CID 50980551) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-(4-hydroxy-4-phenylpiperidin-1-yl)propanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-(4-hydroxy-4-phenylpiperidin-1-yl)propanamide |
|---|---|
| PubChem CID | 50980551 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-(4-hydroxy-4-phenylpiperidin-1-yl)propanamide |
| SMILES | COc1ccc(NC(=O)CCN2CCC(O)(c3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C22H28N2O4/c1-27-18-8-9-19(20(16-18)28-2)23-21(25)10-13-24-14-11-22(26,12-15-24)17-6-4-3-5-7-17/h3-9,16,26H,10-15H2,1-2H3,(H,23,25) |
| InChIKey | PAYKLWTUOARFLL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |