C15H22N2O5S — CID 91830032
N-(2,4-dimethoxyphenyl)-3-(1,1-dioxo-1,4-thiazinan-4-yl)propanamide (PubChem CID 91830032) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-(1,1-dioxo-1,4-thiazinan-4-yl)propanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-(1,1-dioxo-1,4-thiazinan-4-yl)propanamide |
|---|---|
| PubChem CID | 91830032 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-(1,1-dioxo-1,4-thiazinan-4-yl)propanamide |
| SMILES | COc1ccc(NC(=O)CCN2CCS(=O)(=O)CC2)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O5S/c1-21-12-3-4-13(14(11-12)22-2)16-15(18)5-6-17-7-9-23(19,20)10-8-17/h3-4,11H,5-10H2,1-2H3,(H,16,18) |
| InChIKey | GQYUUESDPPZLCW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |