C21H24N2O5S — CID 16595027
N-(5-acetamido-2-methoxyphenyl)-1-(benzenesulfonyl)cyclopentane-1-carboxamide (PubChem CID 16595027) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is N-(5-acetamido-2-methoxyphenyl)-1-(benzenesulfonyl)cyclopentane-1-carboxamide.
| Compound Name | N-(5-acetamido-2-methoxyphenyl)-1-(benzenesulfonyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 16595027 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-(5-acetamido-2-methoxyphenyl)-1-(benzenesulfonyl)cyclopentane-1-carboxamide |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)C1(S(=O)(=O)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C21H24N2O5S/c1-15(24)22-16-10-11-19(28-2)18(14-16)23-20(25)21(12-6-7-13-21)29(26,27)17-8-4-3-5-9-17/h3-5,8-11,14H,6-7,12-13H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | VKPJEAKTXHRAPD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |