C20H23NO5S — CID 24592826
1-(benzenesulfonyl)-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide (PubChem CID 24592826) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 24592826 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(3,4-dimethoxyphenyl)cyclopentane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(S(=O)(=O)c3ccccc3)CCCC2)cc1OC |
| InChI | InChI=1S/C20H23NO5S/c1-25-17-11-10-15(14-18(17)26-2)21-19(22)20(12-6-7-13-20)27(23,24)16-8-4-3-5-9-16/h3-5,8-11,14H,6-7,12-13H2,1-2H3,(H,21,22) |
| InChIKey | QOXVPCYJXCVANM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |