C20H20FNO5S — CID 30473775
methyl 5-[[1-(benzenesulfonyl)cyclopentanecarbonyl]amino]-2-fluorobenzoate (PubChem CID 30473775) has the molecular formula C20H20FNO5S and a molecular weight of 405.45 g/mol. Its IUPAC name is methyl 5-[[1-(benzenesulfonyl)cyclopentanecarbonyl]amino]-2-fluorobenzoate.
| Compound Name | methyl 5-[[1-(benzenesulfonyl)cyclopentanecarbonyl]amino]-2-fluorobenzoate |
|---|---|
| PubChem CID | 30473775 |
| Molecular Formula | C20H20FNO5S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | methyl 5-[[1-(benzenesulfonyl)cyclopentanecarbonyl]amino]-2-fluorobenzoate |
| SMILES | COC(=O)c1cc(NC(=O)C2(S(=O)(=O)c3ccccc3)CCCC2)ccc1F |
| InChI | InChI=1S/C20H20FNO5S/c1-27-18(23)16-13-14(9-10-17(16)21)22-19(24)20(11-5-6-12-20)28(25,26)15-7-3-2-4-8-15/h2-4,7-10,13H,5-6,11-12H2,1H3,(H,22,24) |
| InChIKey | LDHLUWVPFTYKKS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |