C18H18FNO3S — CID 4110794
N-(3-fluoro-4-methylphenyl)-1-(4-methylphenyl)sulfonylcyclopropane-1-carboxamide (PubChem CID 4110794) has the molecular formula C18H18FNO3S and a molecular weight of 347.41 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-1-(4-methylphenyl)sulfonylcyclopropane-1-carboxamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-1-(4-methylphenyl)sulfonylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 4110794 |
| Molecular Formula | C18H18FNO3S |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-1-(4-methylphenyl)sulfonylcyclopropane-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)C2(C(=O)Nc3ccc(C)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C18H18FNO3S/c1-12-3-7-15(8-4-12)24(22,23)18(9-10-18)17(21)20-14-6-5-13(2)16(19)11-14/h3-8,11H,9-10H2,1-2H3,(H,20,21) |
| InChIKey | CFEKOANLKCKGJB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |