C17H16ClNO3S — CID 3434566
N-(3-chlorophenyl)-1-(4-methylphenyl)sulfonylcyclopropane-1-carboxamide (PubChem CID 3434566) has the molecular formula C17H16ClNO3S and a molecular weight of 349.84 g/mol. Its IUPAC name is N-(3-chlorophenyl)-1-(4-methylphenyl)sulfonylcyclopropane-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-1-(4-methylphenyl)sulfonylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 3434566 |
| Molecular Formula | C17H16ClNO3S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | N-(3-chlorophenyl)-1-(4-methylphenyl)sulfonylcyclopropane-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)C2(C(=O)Nc3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C17H16ClNO3S/c1-12-5-7-15(8-6-12)23(21,22)17(9-10-17)16(20)19-14-4-2-3-13(18)11-14/h2-8,11H,9-10H2,1H3,(H,19,20) |
| InChIKey | MYCLZCNWFPKDSB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |