C19H16N2O5S — CID 23760849
N-(1,3-dioxoisoindol-5-yl)-1-(4-methylphenyl)sulfonylcyclopropane-1-carboxamide (PubChem CID 23760849) has the molecular formula C19H16N2O5S and a molecular weight of 384.41 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-5-yl)-1-(4-methylphenyl)sulfonylcyclopropane-1-carboxamide.
| Compound Name | N-(1,3-dioxoisoindol-5-yl)-1-(4-methylphenyl)sulfonylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 23760849 |
| Molecular Formula | C19H16N2O5S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-(1,3-dioxoisoindol-5-yl)-1-(4-methylphenyl)sulfonylcyclopropane-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)C2(C(=O)Nc3ccc4c(c3)C(=O)NC4=O)CC2)cc1 |
| InChI | InChI=1S/C19H16N2O5S/c1-11-2-5-13(6-3-11)27(25,26)19(8-9-19)18(24)20-12-4-7-14-15(10-12)17(23)21-16(14)22/h2-7,10H,8-9H2,1H3,(H,20,24)(H,21,22,23) |
| InChIKey | IPFHSGCGJQHTPB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|