C13H9N3O4 — CID 16880187
N-(1,3-dioxoisoindol-5-yl)-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 16880187) has the molecular formula C13H9N3O4 and a molecular weight of 271.23 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-5-yl)-3-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(1,3-dioxoisoindol-5-yl)-3-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 16880187 |
| Molecular Formula | C13H9N3O4 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | N-(1,3-dioxoisoindol-5-yl)-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc3c(c2)C(=O)NC3=O)on1 |
| InChI | InChI=1S/C13H9N3O4/c1-6-4-10(20-16-6)13(19)14-7-2-3-8-9(5-7)12(18)15-11(8)17/h2-5H,1H3,(H,14,19)(H,15,17,18) |
| InChIKey | QOFYDUVUWFMFOB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|