About 5-bromo-N-(1,3-dioxoisoindol-5-yl)furan-2-carboxamide
5-bromo-N-(1,3-dioxoisoindol-5-yl)furan-2-carboxamide (PubChem CID 2232064) has the molecular formula C13H7BrN2O4
and a molecular weight of 335.11 g/mol. Its IUPAC name is 5-bromo-N-(1,3-dioxoisoindol-5-yl)furan-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-(1,3-dioxoisoindol-5-yl)furan-2-carboxamide |
| PubChem CID | 2232064 |
| Molecular Formula | C13H7BrN2O4 |
| Molecular Weight | 335.11 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 5-bromo-N-(1,3-dioxoisoindol-5-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)NC2=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H7BrN2O4/c14-10-4-3-9(20-10)13(19)15-6-1-2-7-8(5-6)12(18)16-11(7)17/h1-5H,(H,15,19)(H,16,17,18) |
| InChIKey | WGWDXRVJHOJYIL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.11 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-(1,3-dioxoisoindol-5-yl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(1,3-dioxoisoindol-5-yl)furan-2-carboxamide?
The IUPAC name of 5-bromo-N-(1,3-dioxoisoindol-5-yl)furan-2-carboxamide (CID 2232064) is 5-bromo-N-(1,3-dioxoisoindol-5-yl)furan-2-carboxamide.
What is the SMILES notation for 5-bromo-N-(1,3-dioxoisoindol-5-yl)furan-2-carboxamide?
The canonical SMILES for 5-bromo-N-(1,3-dioxoisoindol-5-yl)furan-2-carboxamide is O=C(Nc1ccc2c(c1)C(=O)NC2=O)c1ccc(Br)o1.
What is the InChIKey of 5-bromo-N-(1,3-dioxoisoindol-5-yl)furan-2-carboxamide?
The InChIKey is WGWDXRVJHOJYIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrN2O4/c14-10-4-3-9(20-10)13(19)15-6-1-2-7-8(5-6)12(18)16-11(7)17/h1-5H,(H,15,19)(H,16,17,18).
What are the key properties of 5-bromo-N-(1,3-dioxoisoindol-5-yl)furan-2-carboxamide?
5-bromo-N-(1,3-dioxoisoindol-5-yl)furan-2-carboxamide has a molecular weight of 335.11 g/mol, XLogP of 2.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(1,3-dioxoisoindol-5-yl)furan-2-carboxamide is sourced from PubChem (CID 2232064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).