C8H8N4O2 — CID 43429619
3-methyl-N-(1H-pyrazol-4-yl)-1,2-oxazole-5-carboxamide (PubChem CID 43429619) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is 3-methyl-N-(1H-pyrazol-4-yl)-1,2-oxazole-5-carboxamide.
| Compound Name | 3-methyl-N-(1H-pyrazol-4-yl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 43429619 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 3-methyl-N-(1H-pyrazol-4-yl)-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cn[nH]c2)on1 |
| InChI | InChI=1S/C8H8N4O2/c1-5-2-7(14-12-5)8(13)11-6-3-9-10-4-6/h2-4H,1H3,(H,9,10)(H,11,13) |
| InChIKey | KTVPCGMFDRYTGW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |