C22H18FNO3S — CID 55538756
[4-(thiophene-2-carbonylamino)phenyl] 1-(4-fluorophenyl)cyclobutane-1-carboxylate (PubChem CID 55538756) has the molecular formula C22H18FNO3S and a molecular weight of 395.46 g/mol. Its IUPAC name is [4-(thiophene-2-carbonylamino)phenyl] 1-(4-fluorophenyl)cyclobutane-1-carboxylate.
| Compound Name | [4-(thiophene-2-carbonylamino)phenyl] 1-(4-fluorophenyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 55538756 |
| Molecular Formula | C22H18FNO3S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [4-(thiophene-2-carbonylamino)phenyl] 1-(4-fluorophenyl)cyclobutane-1-carboxylate |
| SMILES | O=C(Nc1ccc(OC(=O)C2(c3ccc(F)cc3)CCC2)cc1)c1cccs1 |
| InChI | InChI=1S/C22H18FNO3S/c23-16-6-4-15(5-7-16)22(12-2-13-22)21(26)27-18-10-8-17(9-11-18)24-20(25)19-3-1-14-28-19/h1,3-11,14H,2,12-13H2,(H,24,25) |
| InChIKey | YZEQIRYCMBLVHC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|