C23H23N3O4S2 — CID 38973808
N-[3-[[(E)-3-[4-(propan-2-ylsulfamoyl)phenyl]prop-2-enoyl]amino]phenyl]thiophene-2-carboxamide (PubChem CID 38973808) has the molecular formula C23H23N3O4S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-[3-[[(E)-3-[4-(propan-2-ylsulfamoyl)phenyl]prop-2-enoyl]amino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[(E)-3-[4-(propan-2-ylsulfamoyl)phenyl]prop-2-enoyl]amino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 38973808 |
| Molecular Formula | C23H23N3O4S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-[3-[[(E)-3-[4-(propan-2-ylsulfamoyl)phenyl]prop-2-enoyl]amino]phenyl]thiophene-2-carboxamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(/C=C/C(=O)Nc2cccc(NC(=O)c3cccs3)c2)cc1 |
| InChI | InChI=1S/C23H23N3O4S2/c1-16(2)26-32(29,30)20-11-8-17(9-12-20)10-13-22(27)24-18-5-3-6-19(15-18)25-23(28)21-7-4-14-31-21/h3-16,26H,1-2H3,(H,24,27)(H,25,28)/b13-10+ |
| InChIKey | CIWINFZXTJOMNW-JLHYYAGUSA-N |
| XLogP | 4.34 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|