C20H20N4O2S — CID 31516122
N-[3-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]phenyl]thiophene-2-carboxamide (PubChem CID 31516122) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[3-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 31516122 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-[3-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]phenyl]thiophene-2-carboxamide |
| SMILES | Cc1nn(C)c(C)c1/C=C/C(=O)Nc1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C20H20N4O2S/c1-13-17(14(2)24(3)23-13)9-10-19(25)21-15-6-4-7-16(12-15)22-20(26)18-8-5-11-27-18/h4-12H,1-3H3,(H,21,25)(H,22,26)/b10-9+ |
| InChIKey | JPMZAYBPPXWFNU-MDZDMXLPSA-N |
| XLogP | 4.00 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|