C16H18FN3O — CID 71904696
N-(2-fluoro-5-methylphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide (PubChem CID 71904696) has the molecular formula C16H18FN3O and a molecular weight of 287.34 g/mol. Its IUPAC name is N-(2-fluoro-5-methylphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide.
| Compound Name | N-(2-fluoro-5-methylphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 71904696 |
| Molecular Formula | C16H18FN3O |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-(2-fluoro-5-methylphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1ccc(F)c(NC(=O)C=Cc2c(C)nn(C)c2C)c1 |
| InChI | InChI=1S/C16H18FN3O/c1-10-5-7-14(17)15(9-10)18-16(21)8-6-13-11(2)19-20(4)12(13)3/h5-9H,1-4H3,(H,18,21) |
| InChIKey | DZINKNNCQKWJOF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|