C25H22N2O2 — CID 40565961
(Z)-2-(1,3-benzoxazol-2-yl)-3-(4-tert-butylphenyl)-1-pyridin-3-ylprop-2-en-1-one (PubChem CID 40565961) has the molecular formula C25H22N2O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is (Z)-2-(1,3-benzoxazol-2-yl)-3-(4-tert-butylphenyl)-1-pyridin-3-ylprop-2-en-1-one.
| Compound Name | (Z)-2-(1,3-benzoxazol-2-yl)-3-(4-tert-butylphenyl)-1-pyridin-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 40565961 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (Z)-2-(1,3-benzoxazol-2-yl)-3-(4-tert-butylphenyl)-1-pyridin-3-ylprop-2-en-1-one |
| SMILES | CC(C)(C)c1ccc(/C=C(\C(=O)c2cccnc2)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C25H22N2O2/c1-25(2,3)19-12-10-17(11-13-19)15-20(23(28)18-7-6-14-26-16-18)24-27-21-8-4-5-9-22(21)29-24/h4-16H,1-3H3/b20-15+ |
| InChIKey | LBWFQDJPFLZZRI-HMMYKYKNSA-N |
| XLogP | 5.94 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|