C11H12N2O2 — CID 173180639
4-amino-1-(1,3-benzoxazol-2-yl)butan-1-one (PubChem CID 173180639) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-amino-1-(1,3-benzoxazol-2-yl)butan-1-one.
| Compound Name | 4-amino-1-(1,3-benzoxazol-2-yl)butan-1-one |
|---|---|
| PubChem CID | 173180639 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 4-amino-1-(1,3-benzoxazol-2-yl)butan-1-one |
| SMILES | NCCCC(=O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C11H12N2O2/c12-7-3-5-9(14)11-13-8-4-1-2-6-10(8)15-11/h1-2,4,6H,3,5,7,12H2 |
| InChIKey | HSFJMRDNFVOYMJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |