C18H18N2O3 — CID 142192293
N-[2-(1,3-benzoxazol-2-yl)-2-oxoethyl]formamide;ethylbenzene (PubChem CID 142192293) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-2-yl)-2-oxoethyl]formamide;ethylbenzene.
| Compound Name | N-[2-(1,3-benzoxazol-2-yl)-2-oxoethyl]formamide;ethylbenzene |
|---|---|
| PubChem CID | 142192293 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-[2-(1,3-benzoxazol-2-yl)-2-oxoethyl]formamide;ethylbenzene |
| SMILES | CCc1ccccc1.O=CNCC(=O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C10H8N2O3.C8H10/c13-6-11-5-8(14)10-12-7-3-1-2-4-9(7)15-10;1-2-8-6-4-3-5-7-8/h1-4,6H,5H2,(H,11,13);3-7H,2H2,1H3 |
| InChIKey | DPRYYEMHIZAYNM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|