C18H18N2O3 — CID 173198520
N-[(1S,2S)-1-(1,3-benzoxazol-2-yl)-1-hydroxy-4-phenylbutan-2-yl]formamide (PubChem CID 173198520) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is N-[(1S,2S)-1-(1,3-benzoxazol-2-yl)-1-hydroxy-4-phenylbutan-2-yl]formamide.
| Compound Name | N-[(1S,2S)-1-(1,3-benzoxazol-2-yl)-1-hydroxy-4-phenylbutan-2-yl]formamide |
|---|---|
| PubChem CID | 173198520 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-[(1S,2S)-1-(1,3-benzoxazol-2-yl)-1-hydroxy-4-phenylbutan-2-yl]formamide |
| SMILES | O=CN[C@@H](CCc1ccccc1)[C@H](O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C18H18N2O3/c21-12-19-15(11-10-13-6-2-1-3-7-13)17(22)18-20-14-8-4-5-9-16(14)23-18/h1-9,12,15,17,22H,10-11H2,(H,19,21)/t15-,17-/m0/s1 |
| InChIKey | NTWJAUMAKNKHMX-RDJZCZTQSA-N |
| XLogP | 2.61 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|