C34H39N3O4 — CID 69473165
N-[1-(1,3-benzoxazol-2-yl)-1-hydroxy-4-phenylbutan-2-yl]-N'-benzyl-2-(cyclohexylmethyl)propanediamide (PubChem CID 69473165) has the molecular formula C34H39N3O4 and a molecular weight of 553.70 g/mol. Its IUPAC name is N-[1-(1,3-benzoxazol-2-yl)-1-hydroxy-4-phenylbutan-2-yl]-N'-benzyl-2-(cyclohexylmethyl)propanediamide.
| Compound Name | N-[1-(1,3-benzoxazol-2-yl)-1-hydroxy-4-phenylbutan-2-yl]-N'-benzyl-2-(cyclohexylmethyl)propanediamide |
|---|---|
| PubChem CID | 69473165 |
| Molecular Formula | C34H39N3O4 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | N-[1-(1,3-benzoxazol-2-yl)-1-hydroxy-4-phenylbutan-2-yl]-N'-benzyl-2-(cyclohexylmethyl)propanediamide |
| SMILES | O=C(NCc1ccccc1)C(CC1CCCCC1)C(=O)NC(CCc1ccccc1)C(O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C34H39N3O4/c38-31(34-37-28-18-10-11-19-30(28)41-34)29(21-20-24-12-4-1-5-13-24)36-33(40)27(22-25-14-6-2-7-15-25)32(39)35-23-26-16-8-3-9-17-26/h1,3-5,8-13,16-19,25,27,29,31,38H,2,6-7,14-15,20-23H2,(H,35,39)(H,36,40) |
| InChIKey | CCWVHVXXSCVUGZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|