C20H25N3O4 — CID 70120632
1-N'-[5-(1,3-benzoxazol-2-yl)-5-oxopentyl]cyclohexane-1,1-dicarboxamide (PubChem CID 70120632) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-N'-[5-(1,3-benzoxazol-2-yl)-5-oxopentyl]cyclohexane-1,1-dicarboxamide.
| Compound Name | 1-N'-[5-(1,3-benzoxazol-2-yl)-5-oxopentyl]cyclohexane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 70120632 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-N'-[5-(1,3-benzoxazol-2-yl)-5-oxopentyl]cyclohexane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)NCCCCC(=O)c2nc3ccccc3o2)CCCCC1 |
| InChI | InChI=1S/C20H25N3O4/c21-18(25)20(11-5-1-6-12-20)19(26)22-13-7-4-9-15(24)17-23-14-8-2-3-10-16(14)27-17/h2-3,8,10H,1,4-7,9,11-13H2,(H2,21,25)(H,22,26) |
| InChIKey | CCFHDSVRYHVSES-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|