C26H31N5O8S — CID 91526231
N-[2-[(1S)-2-[[5-(1,3-benzoxazol-2-yl)-5-oxopentyl]amino]-1-(1-oxidopyridin-1-ium-2-yl)-2-oxoethyl]sulfonylethyl]morpholine-4-carboxamide (PubChem CID 91526231) has the molecular formula C26H31N5O8S and a molecular weight of 573.63 g/mol. Its IUPAC name is N-[2-[(1S)-2-[[5-(1,3-benzoxazol-2-yl)-5-oxopentyl]amino]-1-(1-oxidopyridin-1-ium-2-yl)-2-oxoethyl]sulfonylethyl]morpholine-4-carboxamide.
| Compound Name | N-[2-[(1S)-2-[[5-(1,3-benzoxazol-2-yl)-5-oxopentyl]amino]-1-(1-oxidopyridin-1-ium-2-yl)-2-oxoethyl]sulfonylethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 91526231 |
| Molecular Formula | C26H31N5O8S |
| Molecular Weight | 573.63 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | N-[2-[(1S)-2-[[5-(1,3-benzoxazol-2-yl)-5-oxopentyl]amino]-1-(1-oxidopyridin-1-ium-2-yl)-2-oxoethyl]sulfonylethyl]morpholine-4-carboxamide |
| SMILES | O=C(CCCCNC(=O)[C@H](c1cccc[n+]1[O-])S(=O)(=O)CCNC(=O)N1CCOCC1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C26H31N5O8S/c32-21(25-29-19-7-1-2-10-22(19)39-25)9-3-5-11-27-24(33)23(20-8-4-6-13-31(20)35)40(36,37)18-12-28-26(34)30-14-16-38-17-15-30/h1-2,4,6-8,10,13,23H,3,5,9,11-12,14-18H2,(H,27,33)(H,28,34)/t23-/m0/s1 |
| InChIKey | NZNSVZVKUCMKAW-QHCPKHFHSA-N |
| XLogP | 1.13 |
| TPSA | 174.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.63 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|