C19H11FN2O4S — CID 70239663
2-(1,3-benzoxazole-2-carbonylamino)-4-(2-fluorophenyl)thiophene-3-carboxylic acid (PubChem CID 70239663) has the molecular formula C19H11FN2O4S and a molecular weight of 382.37 g/mol. Its IUPAC name is 2-(1,3-benzoxazole-2-carbonylamino)-4-(2-fluorophenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-(1,3-benzoxazole-2-carbonylamino)-4-(2-fluorophenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 70239663 |
| Molecular Formula | C19H11FN2O4S |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 2-(1,3-benzoxazole-2-carbonylamino)-4-(2-fluorophenyl)thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2ccccc2F)c1C(=O)O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C19H11FN2O4S/c20-12-6-2-1-5-10(12)11-9-27-18(15(11)19(24)25)22-16(23)17-21-13-7-3-4-8-14(13)26-17/h1-9H,(H,22,23)(H,24,25) |
| InChIKey | AKJGBYIFSLQTED-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|