C20H13FN2O4S — CID 58295584
2-(1,3-benzoxazole-2-carbonylamino)-4-(2-fluoro-4-methylphenyl)thiophene-3-carboxylic acid (PubChem CID 58295584) has the molecular formula C20H13FN2O4S and a molecular weight of 396.40 g/mol. Its IUPAC name is 2-(1,3-benzoxazole-2-carbonylamino)-4-(2-fluoro-4-methylphenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-(1,3-benzoxazole-2-carbonylamino)-4-(2-fluoro-4-methylphenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58295584 |
| Molecular Formula | C20H13FN2O4S |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 2-(1,3-benzoxazole-2-carbonylamino)-4-(2-fluoro-4-methylphenyl)thiophene-3-carboxylic acid |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3nc4ccccc4o3)c2C(=O)O)c(F)c1 |
| InChI | InChI=1S/C20H13FN2O4S/c1-10-6-7-11(13(21)8-10)12-9-28-19(16(12)20(25)26)23-17(24)18-22-14-4-2-3-5-15(14)27-18/h2-9H,1H3,(H,23,24)(H,25,26) |
| InChIKey | MHJWGHPULKXBKX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|