C21H13Cl2NO4S — CID 59535990
2-(1-benzofuran-2-carbonylamino)-4-(3,4-dichloro-2-methylphenyl)thiophene-3-carboxylic acid (PubChem CID 59535990) has the molecular formula C21H13Cl2NO4S and a molecular weight of 446.31 g/mol. Its IUPAC name is 2-(1-benzofuran-2-carbonylamino)-4-(3,4-dichloro-2-methylphenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-(1-benzofuran-2-carbonylamino)-4-(3,4-dichloro-2-methylphenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 59535990 |
| Molecular Formula | C21H13Cl2NO4S |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | 2-(1-benzofuran-2-carbonylamino)-4-(3,4-dichloro-2-methylphenyl)thiophene-3-carboxylic acid |
| SMILES | Cc1c(-c2csc(NC(=O)c3cc4ccccc4o3)c2C(=O)O)ccc(Cl)c1Cl |
| InChI | InChI=1S/C21H13Cl2NO4S/c1-10-12(6-7-14(22)18(10)23)13-9-29-20(17(13)21(26)27)24-19(25)16-8-11-4-2-3-5-15(11)28-16/h2-9H,1H3,(H,24,25)(H,26,27) |
| InChIKey | FJEJGWPAEKIGOP-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|