C20H10ClF2NO4S — CID 59536052
2-(1-benzofuran-2-carbonylamino)-4-(4-chloro-3,5-difluorophenyl)thiophene-3-carboxylic acid (PubChem CID 59536052) has the molecular formula C20H10ClF2NO4S and a molecular weight of 433.82 g/mol. Its IUPAC name is 2-(1-benzofuran-2-carbonylamino)-4-(4-chloro-3,5-difluorophenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-(1-benzofuran-2-carbonylamino)-4-(4-chloro-3,5-difluorophenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 59536052 |
| Molecular Formula | C20H10ClF2NO4S |
| Molecular Weight | 433.82 g/mol |
| Exact Mass | 433.00 |
| IUPAC Name | 2-(1-benzofuran-2-carbonylamino)-4-(4-chloro-3,5-difluorophenyl)thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2cc(F)c(Cl)c(F)c2)c1C(=O)O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H10ClF2NO4S/c21-17-12(22)5-10(6-13(17)23)11-8-29-19(16(11)20(26)27)24-18(25)15-7-9-3-1-2-4-14(9)28-15/h1-8H,(H,24,25)(H,26,27) |
| InChIKey | VFRZLUBIUIBWLS-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.82 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|