C21H11ClF2O4S — CID 58295311
2-[2-(1-benzofuran-2-yl)-2-oxoethyl]-4-(4-chloro-3,5-difluorophenyl)thiophene-3-carboxylic acid (PubChem CID 58295311) has the molecular formula C21H11ClF2O4S and a molecular weight of 432.83 g/mol. Its IUPAC name is 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]-4-(4-chloro-3,5-difluorophenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]-4-(4-chloro-3,5-difluorophenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58295311 |
| Molecular Formula | C21H11ClF2O4S |
| Molecular Weight | 432.83 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]-4-(4-chloro-3,5-difluorophenyl)thiophene-3-carboxylic acid |
| SMILES | O=C(Cc1scc(-c2cc(F)c(Cl)c(F)c2)c1C(=O)O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C21H11ClF2O4S/c22-20-13(23)5-11(6-14(20)24)12-9-29-18(19(12)21(26)27)8-15(25)17-7-10-3-1-2-4-16(10)28-17/h1-7,9H,8H2,(H,26,27) |
| InChIKey | ZOKMBEKFRZWKPV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.83 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|