C23H15NO4S — CID 58337803
2-[2-(1-benzofuran-2-yl)-2-oxoethyl]-4-(1H-indol-3-yl)thiophene-3-carboxylic acid (PubChem CID 58337803) has the molecular formula C23H15NO4S and a molecular weight of 401.44 g/mol. Its IUPAC name is 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]-4-(1H-indol-3-yl)thiophene-3-carboxylic acid.
| Compound Name | 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]-4-(1H-indol-3-yl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58337803 |
| Molecular Formula | C23H15NO4S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]-4-(1H-indol-3-yl)thiophene-3-carboxylic acid |
| SMILES | O=C(Cc1scc(-c2c[nH]c3ccccc23)c1C(=O)O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H15NO4S/c25-18(20-9-13-5-1-4-8-19(13)28-20)10-21-22(23(26)27)16(12-29-21)15-11-24-17-7-3-2-6-14(15)17/h1-9,11-12,24H,10H2,(H,26,27) |
| InChIKey | VJISSLAQSNCYQZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |