C20H14O4S2 — CID 58337842
2-[2-(1-benzofuran-2-yl)-2-oxoethyl]-4-(5-methylthiophen-2-yl)thiophene-3-carboxylic acid (PubChem CID 58337842) has the molecular formula C20H14O4S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]-4-(5-methylthiophen-2-yl)thiophene-3-carboxylic acid.
| Compound Name | 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]-4-(5-methylthiophen-2-yl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58337842 |
| Molecular Formula | C20H14O4S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]-4-(5-methylthiophen-2-yl)thiophene-3-carboxylic acid |
| SMILES | Cc1ccc(-c2csc(CC(=O)c3cc4ccccc4o3)c2C(=O)O)s1 |
| InChI | InChI=1S/C20H14O4S2/c1-11-6-7-17(26-11)13-10-25-18(19(13)20(22)23)9-14(21)16-8-12-4-2-3-5-15(12)24-16/h2-8,10H,9H2,1H3,(H,22,23) |
| InChIKey | SVEISAWARCZSAZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |