C20H13NO4S — CID 2360560
2-(1-benzofuran-2-carbonylamino)-4-phenylthiophene-3-carboxylic acid (PubChem CID 2360560) has the molecular formula C20H13NO4S and a molecular weight of 363.39 g/mol. Its IUPAC name is 2-(1-benzofuran-2-carbonylamino)-4-phenylthiophene-3-carboxylic acid.
| Compound Name | 2-(1-benzofuran-2-carbonylamino)-4-phenylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 2360560 |
| Molecular Formula | C20H13NO4S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 2-(1-benzofuran-2-carbonylamino)-4-phenylthiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2ccccc2)c1C(=O)O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H13NO4S/c22-18(16-10-13-8-4-5-9-15(13)25-16)21-19-17(20(23)24)14(11-26-19)12-6-2-1-3-7-12/h1-11H,(H,21,22)(H,23,24) |
| InChIKey | RGJBQCQPLOITTA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|