3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid

C25H16N2O6 — CID 17296766

IUPAC3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid
SMILESO=C(O)c1ccc(NC(=O)c2cc3ccccc3o2)c(NC(=O)c2cc3ccccc3o2)c1
InChIInChI=1S/C25H16N2O6/c28-23(21-12-14-5-1-3-7-19(14)32-21)26-17-10-9-16(25(30)31)11-18(17)27-24(29)22-13-15-6-2-4-8-20(15)33-22/h1-13H,(H,26,28)(H,27,29)(H,30,31)
InChIKeyYVJNVGLQXYOLJX-UHFFFAOYSA-N
MW440.41 g/mol
LogP5.38
Rot. Bonds5

About 3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid

3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid (PubChem CID 17296766) has the molecular formula C25H16N2O6 and a molecular weight of 440.41 g/mol. Its IUPAC name is 3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid.

Molecular Properties

Compound Name3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid
PubChem CID17296766
Molecular FormulaC25H16N2O6
Molecular Weight440.41 g/mol
Exact Mass440.10
IUPAC Name3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid
SMILESO=C(O)c1ccc(NC(=O)c2cc3ccccc3o2)c(NC(=O)c2cc3ccccc3o2)c1
InChIInChI=1S/C25H16N2O6/c28-23(21-12-14-5-1-3-7-19(14)32-21)26-17-10-9-16(25(30)31)11-18(17)27-24(29)22-13-15-6-2-4-8-20(15)33-22/h1-13H,(H,26,28)(H,27,29)(H,30,31)
InChIKeyYVJNVGLQXYOLJX-UHFFFAOYSA-N
XLogP5.38
TPSA121.78 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms33
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500440.41
LogP ≤ 55.38
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid?
The IUPAC name of 3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid (CID 17296766) is 3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid.
What is the SMILES notation for 3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid?
The canonical SMILES for 3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid is O=C(O)c1ccc(NC(=O)c2cc3ccccc3o2)c(NC(=O)c2cc3ccccc3o2)c1.
What is the InChIKey of 3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid?
The InChIKey is YVJNVGLQXYOLJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H16N2O6/c28-23(21-12-14-5-1-3-7-19(14)32-21)26-17-10-9-16(25(30)31)11-18(17)27-24(29)22-13-15-6-2-4-8-20(15)33-22/h1-13H,(H,26,28)(H,27,29)(H,30,31).
What are the key properties of 3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid?
3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid has a molecular weight of 440.41 g/mol, XLogP of 5.38, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(1-benzofuran-2-carbonylamino)benzoic acid is sourced from PubChem (CID 17296766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).