C19H17NO2 — CID 26516067
N-(5,6,7,8-tetrahydronaphthalen-1-yl)-1-benzofuran-2-carboxamide (PubChem CID 26516067) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-(5,6,7,8-tetrahydronaphthalen-1-yl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(5,6,7,8-tetrahydronaphthalen-1-yl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 26516067 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | N-(5,6,7,8-tetrahydronaphthalen-1-yl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1cccc2c1CCCC2)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H17NO2/c21-19(18-12-14-7-2-4-11-17(14)22-18)20-16-10-5-8-13-6-1-3-9-15(13)16/h2,4-5,7-8,10-12H,1,3,6,9H2,(H,20,21) |
| InChIKey | ZELUIRMDHSVHLP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |