C18H13NO5 — CID 3400786
4-methyl-3-[(4-oxochromene-2-carbonyl)amino]benzoic acid (PubChem CID 3400786) has the molecular formula C18H13NO5 and a molecular weight of 323.30 g/mol. Its IUPAC name is 4-methyl-3-[(4-oxochromene-2-carbonyl)amino]benzoic acid.
| Compound Name | 4-methyl-3-[(4-oxochromene-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 3400786 |
| Molecular Formula | C18H13NO5 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 4-methyl-3-[(4-oxochromene-2-carbonyl)amino]benzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C18H13NO5/c1-10-6-7-11(18(22)23)8-13(10)19-17(21)16-9-14(20)12-4-2-3-5-15(12)24-16/h2-9H,1H3,(H,19,21)(H,22,23) |
| InChIKey | GLEMCRZXGDZSQS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |