C17H9ClF3NO3 — CID 17014479
N-[2-chloro-5-(trifluoromethyl)phenyl]-4-oxochromene-2-carboxamide (PubChem CID 17014479) has the molecular formula C17H9ClF3NO3 and a molecular weight of 367.71 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 17014479 |
| Molecular Formula | C17H9ClF3NO3 |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-oxochromene-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C17H9ClF3NO3/c18-11-6-5-9(17(19,20)21)7-12(11)22-16(24)15-8-13(23)10-3-1-2-4-14(10)25-15/h1-8H,(H,22,24) |
| InChIKey | DVUVCKRHOVEYMQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |