C19H16ClNO5 — CID 47081673
N-[3-chloro-2-(2-methoxyethoxy)phenyl]-4-oxochromene-2-carboxamide (PubChem CID 47081673) has the molecular formula C19H16ClNO5 and a molecular weight of 373.79 g/mol. Its IUPAC name is N-[3-chloro-2-(2-methoxyethoxy)phenyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[3-chloro-2-(2-methoxyethoxy)phenyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 47081673 |
| Molecular Formula | C19H16ClNO5 |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-[3-chloro-2-(2-methoxyethoxy)phenyl]-4-oxochromene-2-carboxamide |
| SMILES | COCCOc1c(Cl)cccc1NC(=O)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C19H16ClNO5/c1-24-9-10-25-18-13(20)6-4-7-14(18)21-19(23)17-11-15(22)12-5-2-3-8-16(12)26-17/h2-8,11H,9-10H2,1H3,(H,21,23) |
| InChIKey | ZAKOVJNMQOPYQD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|