C18H11ClF3NO3 — CID 19119011
N-[2-chloro-5-(trifluoromethyl)phenyl]-8-methyl-4-oxochromene-2-carboxamide (PubChem CID 19119011) has the molecular formula C18H11ClF3NO3 and a molecular weight of 381.74 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-8-methyl-4-oxochromene-2-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-8-methyl-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 19119011 |
| Molecular Formula | C18H11ClF3NO3 |
| Molecular Weight | 381.74 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-8-methyl-4-oxochromene-2-carboxamide |
| SMILES | Cc1cccc2c(=O)cc(C(=O)Nc3cc(C(F)(F)F)ccc3Cl)oc12 |
| InChI | InChI=1S/C18H11ClF3NO3/c1-9-3-2-4-11-14(24)8-15(26-16(9)11)17(25)23-13-7-10(18(20,21)22)5-6-12(13)19/h2-8H,1H3,(H,23,25) |
| InChIKey | KJTWHTXHSRHKGM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.74 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |