C21H10Cl2N2O4S — CID 59536002
2-(1-benzofuran-2-carbonylamino)-4-(2,4-dichloro-3-isocyanophenyl)thiophene-3-carboxylic acid (PubChem CID 59536002) has the molecular formula C21H10Cl2N2O4S and a molecular weight of 457.29 g/mol. Its IUPAC name is 2-(1-benzofuran-2-carbonylamino)-4-(2,4-dichloro-3-isocyanophenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-(1-benzofuran-2-carbonylamino)-4-(2,4-dichloro-3-isocyanophenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 59536002 |
| Molecular Formula | C21H10Cl2N2O4S |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 455.97 |
| IUPAC Name | 2-(1-benzofuran-2-carbonylamino)-4-(2,4-dichloro-3-isocyanophenyl)thiophene-3-carboxylic acid |
| SMILES | [C-]#[N+]c1c(Cl)ccc(-c2csc(NC(=O)c3cc4ccccc4o3)c2C(=O)O)c1Cl |
| InChI | InChI=1S/C21H10Cl2N2O4S/c1-24-18-13(22)7-6-11(17(18)23)12-9-30-20(16(12)21(27)28)25-19(26)15-8-10-4-2-3-5-14(10)29-15/h2-9H,(H,25,26)(H,27,28) |
| InChIKey | KIDFUZIERYFSOM-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|