C24H22F3N3O4S — CID 143950022
2-(1-benzofuran-2-carbonylamino)-4-(2,6-difluoro-3-pyridinyl)thiophene-3-carboxylic acid;ethane;N-methylethanimidoyl fluoride (PubChem CID 143950022) has the molecular formula C24H22F3N3O4S and a molecular weight of 505.52 g/mol. Its IUPAC name is 2-(1-benzofuran-2-carbonylamino)-4-(2,6-difluoro-3-pyridinyl)thiophene-3-carboxylic acid;ethane;N-methylethanimidoyl fluoride.
| Compound Name | 2-(1-benzofuran-2-carbonylamino)-4-(2,6-difluoro-3-pyridinyl)thiophene-3-carboxylic acid;ethane;N-methylethanimidoyl fluoride |
|---|---|
| PubChem CID | 143950022 |
| Molecular Formula | C24H22F3N3O4S |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 2-(1-benzofuran-2-carbonylamino)-4-(2,6-difluoro-3-pyridinyl)thiophene-3-carboxylic acid;ethane;N-methylethanimidoyl fluoride |
| SMILES | C/N=C(\C)F.CC.O=C(Nc1scc(-c2ccc(F)nc2F)c1C(=O)O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H10F2N2O4S.C3H6FN.C2H6/c20-14-6-5-10(16(21)22-14)11-8-28-18(15(11)19(25)26)23-17(24)13-7-9-3-1-2-4-12(9)27-13;1-3(4)5-2;1-2/h1-8H,(H,23,24)(H,25,26);1-2H3;1-2H3/b;5-3+; |
| InChIKey | IYTCWTGWSOCWJV-PTDWBMLLSA-N |
| XLogP | 6.82 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|